C27H23O8S2+ — CID 173480656
(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[4-(9-oxo-8aH-thioxanthen-10-yl)phenoxy]acetate (PubChem CID 173480656) has the molecular formula C27H23O8S2+ and a molecular weight of 539.61 g/mol. Its IUPAC name is (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[4-(9-oxo-8aH-thioxanthen-10-yl)phenoxy]acetate.
| Compound Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[4-(9-oxo-8aH-thioxanthen-10-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 173480656 |
| Molecular Formula | C27H23O8S2+ |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-[4-(9-oxo-8aH-thioxanthen-10-yl)phenoxy]acetate |
| SMILES | O=C(COc1ccc([SH+]2=C3C=CC=CC3C(=O)c3ccccc32)cc1)OC1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C27H22O8S2/c28-23(34-25-19-13-22-26(33-19)27(25)35-37(22,30)31)14-32-15-9-11-16(12-10-15)36-20-7-3-1-5-17(20)24(29)18-6-2-4-8-21(18)36/h1-12,17,19,22,25-27H,13-14H2/p+1 |
| InChIKey | BDCFFIKXBBIJFG-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|