C16H21F3N2O — CID 173481339
4-amino-N-[(4S)-2,4-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 173481339) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-amino-N-[(4S)-2,4-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 4-amino-N-[(4S)-2,4-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 173481339 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-amino-N-[(4S)-2,4-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1=C[C@@](C)(C(F)(F)F)CCC1NC(=O)C1=CCC(N)C=C1 |
| InChI | InChI=1S/C16H21F3N2O/c1-10-9-15(2,16(17,18)19)8-7-13(10)21-14(22)11-3-5-12(20)6-4-11/h3-5,9,12-13H,6-8,20H2,1-2H3,(H,21,22)/t12?,13?,15-/m0/s1 |
| InChIKey | SNMGJKIVCOQOON-PIMMBPRGSA-N |
| XLogP | 2.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|