About dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium
dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium (PubChem CID 173481346) has the molecular formula H4MnO7Ti
and a molecular weight of 218.83 g/mol. Its IUPAC name is dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium.
Molecular Properties
| Compound Name | dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium |
| PubChem CID | 173481346 |
| Molecular Formula | H4MnO7Ti |
| Molecular Weight | 218.83 g/mol |
| Exact Mass | 218.88 |
| IUPAC Name | dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium |
| SMILES | O=[Mn](=O)(O)O.O=[Ti](O)O |
| InChI | InChI=1S/Mn.4H2O.3O.Ti/h;4*1H2;;;;/q+2;;;;;;;;+2/p-4 |
| InChIKey | RFYNVTGKUFVNIW-UHFFFAOYSA-J |
| XLogP | -2.59 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.83 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium?
The IUPAC name of dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium (CID 173481346) is dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium.
What is the SMILES notation for dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium?
The canonical SMILES for dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium is O=[Mn](=O)(O)O.O=[Ti](O)O.
What is the InChIKey of dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium?
The InChIKey is RFYNVTGKUFVNIW-UHFFFAOYSA-J. The full InChI is InChI=1S/Mn.4H2O.3O.Ti/h;4*1H2;;;;/q+2;;;;;;;;+2/p-4.
What are the key properties of dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium?
dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium has a molecular weight of 218.83 g/mol, XLogP of -2.59, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)manganese;dihydroxy(oxo)titanium is sourced from PubChem (CID 173481346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).