About (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine
(7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine (PubChem CID 173481404) has the molecular formula C11H13ClS
and a molecular weight of 212.75 g/mol. Its IUPAC name is (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine.
Molecular Properties
| Compound Name | (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine |
| PubChem CID | 173481404 |
| Molecular Formula | C11H13ClS |
| Molecular Weight | 212.75 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine |
| SMILES | C=C1CCS/C=C/C=C(/Cl)C=C1C |
| InChI | InChI=1S/C11H13ClS/c1-9-5-7-13-6-3-4-11(12)8-10(9)2/h3-4,6,8H,1,5,7H2,2H3/b6-3+,10-8?,11-4+ |
| InChIKey | PPQVFIGCGVKZTG-ZWSKYZSMSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine?
The IUPAC name of (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine (CID 173481404) is (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine.
What is the SMILES notation for (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine?
The canonical SMILES for (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine is C=C1CCS/C=C/C=C(/Cl)C=C1C.
What is the InChIKey of (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine?
The InChIKey is PPQVFIGCGVKZTG-ZWSKYZSMSA-N. The full InChI is InChI=1S/C11H13ClS/c1-9-5-7-13-6-3-4-11(12)8-10(9)2/h3-4,6,8H,1,5,7H2,2H3/b6-3+,10-8?,11-4+.
What are the key properties of (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine?
(7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine has a molecular weight of 212.75 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7E,9E)-7-chloro-5-methyl-4-methylidene-2,3-dihydrothiecine is sourced from PubChem (CID 173481404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).