C28H37N3O — CID 173481594
(2E,4E)-8-(cyclohexa-1,3-dien-1-ylamino)-2-ethenyl-5-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-8-(prop-2-enylideneamino)octa-2,4-dienamide (PubChem CID 173481594) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is (2E,4E)-8-(cyclohexa-1,3-dien-1-ylamino)-2-ethenyl-5-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-8-(prop-2-enylideneamino)octa-2,4-dienamide.
| Compound Name | (2E,4E)-8-(cyclohexa-1,3-dien-1-ylamino)-2-ethenyl-5-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-8-(prop-2-enylideneamino)octa-2,4-dienamide |
|---|---|
| PubChem CID | 173481594 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (2E,4E)-8-(cyclohexa-1,3-dien-1-ylamino)-2-ethenyl-5-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-8-(prop-2-enylideneamino)octa-2,4-dienamide |
| SMILES | C=CC=NC(CC/C(C)=C/C=C(\C=C)C(=O)NC/C(C)=C/C=C\C=C)NC1=CC=CCC1 |
| InChI | InChI=1S/C28H37N3O/c1-6-9-11-14-24(5)22-30-28(32)25(8-3)19-17-23(4)18-20-27(29-21-7-2)31-26-15-12-10-13-16-26/h6-12,14-15,17,19,21,27,31H,1-3,13,16,18,20,22H2,4-5H3,(H,30,32)/b11-9-,23-17+,24-14+,25-19+,29-21? |
| InChIKey | AUSPHQIOIWVGEZ-AFLYVZEWSA-N |
| XLogP | 6.04 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|