C10H17N5O4 — CID 173481596
2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetic acid (PubChem CID 173481596) has the molecular formula C10H17N5O4 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetic acid.
| Compound Name | 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetic acid |
|---|---|
| PubChem CID | 173481596 |
| Molecular Formula | C10H17N5O4 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetic acid |
| SMILES | [H]/N=C1\NC(=O)N(CCN(C)C)C(=O)C1NCC(=O)O |
| InChI | InChI=1S/C10H17N5O4/c1-14(2)3-4-15-9(18)7(12-5-6(16)17)8(11)13-10(15)19/h7,12H,3-5H2,1-2H3,(H,16,17)(H2,11,13,19) |
| InChIKey | VFGMLVXHBZTBCO-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|