C7H10N4O4 — CID 173481597
2-[(4-imino-1-methyl-2,6-dioxo-1,3-diazinan-5-yl)amino]acetic acid (PubChem CID 173481597) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-[(4-imino-1-methyl-2,6-dioxo-1,3-diazinan-5-yl)amino]acetic acid.
| Compound Name | 2-[(4-imino-1-methyl-2,6-dioxo-1,3-diazinan-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 173481597 |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-[(4-imino-1-methyl-2,6-dioxo-1,3-diazinan-5-yl)amino]acetic acid |
| SMILES | [H]/N=C1\NC(=O)N(C)C(=O)C1NCC(=O)O |
| InChI | InChI=1S/C7H10N4O4/c1-11-6(14)4(9-2-3(12)13)5(8)10-7(11)15/h4,9H,2H2,1H3,(H,12,13)(H2,8,10,15) |
| InChIKey | SNCJOACFAOHASS-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|