C9H14N4O4 — CID 173481601
2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetic acid (PubChem CID 173481601) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetic acid.
| Compound Name | 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 173481601 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetic acid |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C(=O)C1NCC(=O)O |
| InChI | InChI=1S/C9H14N4O4/c1-2-3-13-8(16)6(11-4-5(14)15)7(10)12-9(13)17/h6,11H,2-4H2,1H3,(H,14,15)(H2,10,12,17) |
| InChIKey | ZAWWURQTVNVGNR-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|