C15H15NO2S — CID 173481694
4,6-dimethyl-3-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-1H-pyridin-2-one (PubChem CID 173481694) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 4,6-dimethyl-3-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-1H-pyridin-2-one.
| Compound Name | 4,6-dimethyl-3-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 173481694 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4,6-dimethyl-3-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-1H-pyridin-2-one |
| SMILES | Cc1cc(C)c(C(=O)/C=C/c2ccc(C)s2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H15NO2S/c1-9-8-10(2)16-15(18)14(9)13(17)7-6-12-5-4-11(3)19-12/h4-8H,1-3H3,(H,16,18)/b7-6+ |
| InChIKey | MVUSUMPFUZAKJV-VOTSOKGWSA-N |
| XLogP | 3.26 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|