C13H17NOS — CID 173481893
(6E)-6-[(2E)-3,4-dimethylpenta-2,4-dienylidene]-5-ethylidenethiomorpholin-3-one (PubChem CID 173481893) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is (6E)-6-[(2E)-3,4-dimethylpenta-2,4-dienylidene]-5-ethylidenethiomorpholin-3-one.
| Compound Name | (6E)-6-[(2E)-3,4-dimethylpenta-2,4-dienylidene]-5-ethylidenethiomorpholin-3-one |
|---|---|
| PubChem CID | 173481893 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (6E)-6-[(2E)-3,4-dimethylpenta-2,4-dienylidene]-5-ethylidenethiomorpholin-3-one |
| SMILES | C=C(C)/C(C)=C/C=C1/SCC(=O)NC1=CC |
| InChI | InChI=1S/C13H17NOS/c1-5-11-12(16-8-13(15)14-11)7-6-10(4)9(2)3/h5-7H,2,8H2,1,3-4H3,(H,14,15)/b10-6+,11-5?,12-7+ |
| InChIKey | QZUGZAONQFUKCR-KEYXWSBFSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|