About 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum
2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum (PubChem CID 173481982) has the molecular formula C8H8FLa-
and a molecular weight of 262.06 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum.
Molecular Properties
| Compound Name | 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum |
| PubChem CID | 173481982 |
| Molecular Formula | C8H8FLa- |
| Molecular Weight | 262.06 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum |
| SMILES | Cc1c[c-]c(C)c(F)c1.[La] |
| InChI | InChI=1S/C8H8F.La/c1-6-3-4-7(2)8(9)5-6;/h3,5H,1-2H3;/q-1; |
| InChIKey | YJCLHEJQJRSHSB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.06 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum?
The IUPAC name of 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum (CID 173481982) is 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum.
What is the SMILES notation for 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum?
The canonical SMILES for 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum is Cc1c[c-]c(C)c(F)c1.[La].
What is the InChIKey of 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum?
The InChIKey is YJCLHEJQJRSHSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F.La/c1-6-3-4-7(2)8(9)5-6;/h3,5H,1-2H3;/q-1;.
What are the key properties of 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum?
2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum has a molecular weight of 262.06 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,4-dimethylbenzene-6-ide;lanthanum is sourced from PubChem (CID 173481982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).