C36H34F3N2O+ — CID 173482087
3-butyl-2-[3-[1,3-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]benzo[e]indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium (PubChem CID 173482087) has the molecular formula C36H34F3N2O+ and a molecular weight of 567.68 g/mol. Its IUPAC name is 3-butyl-2-[3-[1,3-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]benzo[e]indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium.
| Compound Name | 3-butyl-2-[3-[1,3-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]benzo[e]indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 173482087 |
| Molecular Formula | C36H34F3N2O+ |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 3-butyl-2-[3-[1,3-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]benzo[e]indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium |
| SMILES | CCCC[n+]1c(C=CC=C2N(C)c3ccc4ccccc4c3C2(C)Cc2ccc(C(F)(F)F)cc2)oc2ccccc21 |
| InChI | InChI=1S/C36H34F3N2O/c1-4-5-23-41-29-13-8-9-14-31(29)42-33(41)16-10-15-32-35(2,24-25-17-20-27(21-18-25)36(37,38)39)34-28-12-7-6-11-26(28)19-22-30(34)40(32)3/h6-22H,4-5,23-24H2,1-3H3/q+1 |
| InChIKey | GFUSWCWIZYDDRD-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|