C22H25N5O3 — CID 173483172
3-[(Z)-2-aminoethenyl]-5-methylidene-12,19-dioxa-2,4,6,15-tetrazatricyclo[18.3.1.17,11]pentacosa-1(24),3,7(25),8,10,20,22-heptaen-14-one (PubChem CID 173483172) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[(Z)-2-aminoethenyl]-5-methylidene-12,19-dioxa-2,4,6,15-tetrazatricyclo[18.3.1.17,11]pentacosa-1(24),3,7(25),8,10,20,22-heptaen-14-one.
| Compound Name | 3-[(Z)-2-aminoethenyl]-5-methylidene-12,19-dioxa-2,4,6,15-tetrazatricyclo[18.3.1.17,11]pentacosa-1(24),3,7(25),8,10,20,22-heptaen-14-one |
|---|---|
| PubChem CID | 173483172 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 3-[(Z)-2-aminoethenyl]-5-methylidene-12,19-dioxa-2,4,6,15-tetrazatricyclo[18.3.1.17,11]pentacosa-1(24),3,7(25),8,10,20,22-heptaen-14-one |
| SMILES | C=C1N=C(/C=C\N)Nc2cccc(c2)OCCCNC(=O)COc2cccc(c2)N1 |
| InChI | InChI=1S/C22H25N5O3/c1-16-25-17-5-2-8-20(13-17)30-15-22(28)24-11-4-12-29-19-7-3-6-18(14-19)27-21(26-16)9-10-23/h2-3,5-10,13-14,25H,1,4,11-12,15,23H2,(H,24,28)(H,26,27)/b10-9- |
| InChIKey | CZWKIWFYQCJESC-KTKRTIGZSA-N |
| XLogP | 2.83 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |