C9H9F2NO — CID 173483727
[1-(2,4-difluorophenyl)ethylideneamino]methanol (PubChem CID 173483727) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is [1-(2,4-difluorophenyl)ethylideneamino]methanol.
| Compound Name | [1-(2,4-difluorophenyl)ethylideneamino]methanol |
|---|---|
| PubChem CID | 173483727 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | [1-(2,4-difluorophenyl)ethylideneamino]methanol |
| SMILES | CC(=NCO)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2NO/c1-6(12-5-13)8-3-2-7(10)4-9(8)11/h2-4,13H,5H2,1H3 |
| InChIKey | HIGKZGSEGCHFAA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|