C14H27LiN2O3 — CID 173484127
lithium;2-(diethylcarbamoylamino)-3-(1-methylcyclopentyl)propanoic acid;hydride (PubChem CID 173484127) has the molecular formula C14H27LiN2O3 and a molecular weight of 278.32 g/mol. Its IUPAC name is lithium;2-(diethylcarbamoylamino)-3-(1-methylcyclopentyl)propanoic acid;hydride.
| Compound Name | lithium;2-(diethylcarbamoylamino)-3-(1-methylcyclopentyl)propanoic acid;hydride |
|---|---|
| PubChem CID | 173484127 |
| Molecular Formula | C14H27LiN2O3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | lithium;2-(diethylcarbamoylamino)-3-(1-methylcyclopentyl)propanoic acid;hydride |
| SMILES | CCN(CC)C(=O)NC(CC1(C)CCCC1)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C14H26N2O3.Li.H/c1-4-16(5-2)13(19)15-11(12(17)18)10-14(3)8-6-7-9-14;;/h11H,4-10H2,1-3H3,(H,15,19)(H,17,18);;/q;+1;-1 |
| InChIKey | YIDNYZOIXXLSRT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |