C27H28N2O8 — CID 173484354
(1S,10R,13S)-10-(hydroxymethyl)-7,8,18-trimethoxy-5,6,17,21-tetramethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),17-hexaene-12,14,16,19-tetrone (PubChem CID 173484354) has the molecular formula C27H28N2O8 and a molecular weight of 508.53 g/mol. Its IUPAC name is (1S,10R,13S)-10-(hydroxymethyl)-7,8,18-trimethoxy-5,6,17,21-tetramethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),17-hexaene-12,14,16,19-tetrone.
| Compound Name | (1S,10R,13S)-10-(hydroxymethyl)-7,8,18-trimethoxy-5,6,17,21-tetramethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),17-hexaene-12,14,16,19-tetrone |
|---|---|
| PubChem CID | 173484354 |
| Molecular Formula | C27H28N2O8 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (1S,10R,13S)-10-(hydroxymethyl)-7,8,18-trimethoxy-5,6,17,21-tetramethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),17-hexaene-12,14,16,19-tetrone |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)[C@H]1C3=Cc4c(C)c(C)c(OC)c(OC)c4[C@H](CO)N3C(=O)[C@H](C2=O)N1C |
| InChI | InChI=1S/C27H28N2O8/c1-10-11(2)25(36-6)26(37-7)16-13(10)8-14-19-17-18(21(31)12(3)24(35-5)23(17)33)22(32)20(28(19)4)27(34)29(14)15(16)9-30/h8,15,19-20,30H,9H2,1-7H3/t15-,19+,20-/m0/s1 |
| InChIKey | DQSJVGKKGVWRRE-BEVDRBHNSA-N |
| XLogP | 1.17 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|