About [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol
[(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol (PubChem CID 173484706) has the molecular formula C7H7Cl2IO
and a molecular weight of 304.94 g/mol. Its IUPAC name is [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol |
| PubChem CID | 173484706 |
| Molecular Formula | C7H7Cl2IO |
| Molecular Weight | 304.94 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol |
| SMILES | OCC1=C[C@](Cl)(I)C(Cl)C=C1 |
| InChI | InChI=1S/C7H7Cl2IO/c8-6-2-1-5(4-11)3-7(6,9)10/h1-3,6,11H,4H2/t6?,7-/m0/s1 |
| InChIKey | OYMKFBCPPYKXMT-MLWJPKLSSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.94 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol?
The IUPAC name of [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol (CID 173484706) is [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol.
What is the SMILES notation for [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol?
The canonical SMILES for [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol is OCC1=C[C@](Cl)(I)C(Cl)C=C1.
What is the InChIKey of [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol?
The InChIKey is OYMKFBCPPYKXMT-MLWJPKLSSA-N. The full InChI is InChI=1S/C7H7Cl2IO/c8-6-2-1-5(4-11)3-7(6,9)10/h1-3,6,11H,4H2/t6?,7-/m0/s1.
What are the key properties of [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol?
[(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol has a molecular weight of 304.94 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3,4-dichloro-3-iodocyclohexa-1,5-dien-1-yl]methanol is sourced from PubChem (CID 173484706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).