C49H35NS — CID 173485421
10-[7-[(1Z,4Z,6Z)-8-methylidene-10-phenylcyclodeca-1,4,6,9-tetraen-1-yl]-9-phenylphenanthren-2-yl]phenothiazine (PubChem CID 173485421) has the molecular formula C49H35NS and a molecular weight of 669.89 g/mol. Its IUPAC name is 10-[7-[(1Z,4Z,6Z)-8-methylidene-10-phenylcyclodeca-1,4,6,9-tetraen-1-yl]-9-phenylphenanthren-2-yl]phenothiazine.
| Compound Name | 10-[7-[(1Z,4Z,6Z)-8-methylidene-10-phenylcyclodeca-1,4,6,9-tetraen-1-yl]-9-phenylphenanthren-2-yl]phenothiazine |
|---|---|
| PubChem CID | 173485421 |
| Molecular Formula | C49H35NS |
| Molecular Weight | 669.89 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 10-[7-[(1Z,4Z,6Z)-8-methylidene-10-phenylcyclodeca-1,4,6,9-tetraen-1-yl]-9-phenylphenanthren-2-yl]phenothiazine |
| SMILES | C=C1C=C(c2ccccc2)/C(c2ccc3c(c2)c(-c2ccccc2)cc2cc(N4c5ccccc5Sc5ccccc54)ccc23)=C\C/C=C\C=C/1 |
| InChI | InChI=1S/C49H35NS/c1-34-16-6-2-3-11-21-40(43(30-34)35-17-7-4-8-18-35)37-26-28-42-41-29-27-39(31-38(41)33-44(45(42)32-37)36-19-9-5-10-20-36)50-46-22-12-14-24-48(46)51-49-25-15-13-23-47(49)50/h2-10,12-33H,1,11H2/b3-2-,16-6-,40-21-,43-30? |
| InChIKey | QZKZWZDUVQCZEV-IQXNGRFOSA-N |
| XLogP | 14.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.89 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|