About 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride
4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride (PubChem CID 173485890) has the molecular formula C15H18Cl3N3
and a molecular weight of 346.69 g/mol. Its IUPAC name is 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride.
Molecular Properties
| Compound Name | 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride |
| PubChem CID | 173485890 |
| Molecular Formula | C15H18Cl3N3 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride |
| SMILES | CCN1CC(C)=Cc2ccccc21.Cl.Clc1nc[nH]c1Cl |
| InChI | InChI=1S/C12H15N.C3H2Cl2N2.ClH/c1-3-13-9-10(2)8-11-6-4-5-7-12(11)13;4-2-3(5)7-1-6-2;/h4-8H,3,9H2,1-2H3;1H,(H,6,7);1H |
| InChIKey | JEGZWCIAOIMTFI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride?
The IUPAC name of 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride (CID 173485890) is 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride.
What is the SMILES notation for 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride?
The canonical SMILES for 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride is CCN1CC(C)=Cc2ccccc21.Cl.Clc1nc[nH]c1Cl.
What is the InChIKey of 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride?
The InChIKey is JEGZWCIAOIMTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C3H2Cl2N2.ClH/c1-3-13-9-10(2)8-11-6-4-5-7-12(11)13;4-2-3(5)7-1-6-2;/h4-8H,3,9H2,1-2H3;1H,(H,6,7);1H.
What are the key properties of 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride?
4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride has a molecular weight of 346.69 g/mol, XLogP of 5.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-1H-imidazole;1-ethyl-3-methyl-2H-quinoline;hydrochloride is sourced from PubChem (CID 173485890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).