C28H30FN7O3S — CID 173486061
[N-[2-[5-(dimethylamino)-13-[4-(dimethylcarbamoyl)-3-fluorophenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate (PubChem CID 173486061) has the molecular formula C28H30FN7O3S and a molecular weight of 563.66 g/mol. Its IUPAC name is [N-[2-[5-(dimethylamino)-13-[4-(dimethylcarbamoyl)-3-fluorophenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate.
| Compound Name | [N-[2-[5-(dimethylamino)-13-[4-(dimethylcarbamoyl)-3-fluorophenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate |
|---|---|
| PubChem CID | 173486061 |
| Molecular Formula | C28H30FN7O3S |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | [N-[2-[5-(dimethylamino)-13-[4-(dimethylcarbamoyl)-3-fluorophenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate |
| SMILES | [H]/N=C(/NC(=O)C(C)(C)C1c2ccc(-c3ccc(C(=O)N(C)C)c(F)c3)nc2Oc2nc(N(C)C)ccc21)S/C=N/[H] |
| InChI | InChI=1S/C28H30FN7O3S/c1-28(2,26(38)34-27(31)40-14-30)22-17-9-11-20(15-7-8-16(19(29)13-15)25(37)36(5)6)32-23(17)39-24-18(22)10-12-21(33-24)35(3)4/h7-14,22,30H,1-6H3,(H2,31,34,38)/b30-14+ |
| InChIKey | SKOPOZPYWRGOOM-AMVVHIIESA-N |
| XLogP | 4.71 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|