C26H25I — CID 173486134
2-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-propylideneinden-5-yl]naphthalene (PubChem CID 173486134) has the molecular formula C26H25I and a molecular weight of 464.39 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-propylideneinden-5-yl]naphthalene.
| Compound Name | 2-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-propylideneinden-5-yl]naphthalene |
|---|---|
| PubChem CID | 173486134 |
| Molecular Formula | C26H25I |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-propylideneinden-5-yl]naphthalene |
| SMILES | CCC=C1/C(=C\CI)C(C)(C)c2cc(-c3ccc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C26H25I/c1-4-7-22-23-13-12-21(17-25(23)26(2,3)24(22)14-15-27)20-11-10-18-8-5-6-9-19(18)16-20/h5-14,16-17H,4,15H2,1-3H3/b22-7?,24-14+ |
| InChIKey | AXXUJPHSXCDBEW-NYGPUHTKSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|