About 2-methyl-1,2-dihydroimidazol-5-one
2-methyl-1,2-dihydroimidazol-5-one (PubChem CID 173486189) has the molecular formula C4H6N2O
and a molecular weight of 98.10 g/mol. Its IUPAC name is 2-methyl-1,2-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-methyl-1,2-dihydroimidazol-5-one |
| PubChem CID | 173486189 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | 2-methyl-1,2-dihydroimidazol-5-one |
| SMILES | CC1N=CC(=O)N1 |
| InChI | InChI=1S/C4H6N2O/c1-3-5-2-4(7)6-3/h2-3H,1H3,(H,6,7) |
| InChIKey | WGLRSTDYFMBDHD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1,2-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2-dihydroimidazol-5-one?
The IUPAC name of 2-methyl-1,2-dihydroimidazol-5-one (CID 173486189) is 2-methyl-1,2-dihydroimidazol-5-one.
What is the SMILES notation for 2-methyl-1,2-dihydroimidazol-5-one?
The canonical SMILES for 2-methyl-1,2-dihydroimidazol-5-one is CC1N=CC(=O)N1.
What is the InChIKey of 2-methyl-1,2-dihydroimidazol-5-one?
The InChIKey is WGLRSTDYFMBDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O/c1-3-5-2-4(7)6-3/h2-3H,1H3,(H,6,7).
What are the key properties of 2-methyl-1,2-dihydroimidazol-5-one?
2-methyl-1,2-dihydroimidazol-5-one has a molecular weight of 98.10 g/mol, XLogP of -0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2-dihydroimidazol-5-one is sourced from PubChem (CID 173486189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).