About (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine
(Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine (PubChem CID 173486356) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine.
Molecular Properties
| Compound Name | (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine |
| PubChem CID | 173486356 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine |
| SMILES | CCCCC[C@H]1N[C@H]1CC/C=C\C(C)(C)N |
| InChI | InChI=1S/C14H28N2/c1-4-5-6-9-12-13(16-12)10-7-8-11-14(2,3)15/h8,11-13,16H,4-7,9-10,15H2,1-3H3/b11-8-/t12-,13+/m1/s1 |
| InChIKey | SSIHVPYBCXSYDI-ASDJVNKTSA-N |
| XLogP | 2.98 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine?
The IUPAC name of (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine (CID 173486356) is (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine.
What is the SMILES notation for (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine?
The canonical SMILES for (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine is CCCCC[C@H]1N[C@H]1CC/C=C\C(C)(C)N.
What is the InChIKey of (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine?
The InChIKey is SSIHVPYBCXSYDI-ASDJVNKTSA-N. The full InChI is InChI=1S/C14H28N2/c1-4-5-6-9-12-13(16-12)10-7-8-11-14(2,3)15/h8,11-13,16H,4-7,9-10,15H2,1-3H3/b11-8-/t12-,13+/m1/s1.
What are the key properties of (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine?
(Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine has a molecular weight of 224.39 g/mol, XLogP of 2.98, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methyl-6-[(2S,3R)-3-pentylaziridin-2-yl]hex-3-en-2-amine is sourced from PubChem (CID 173486356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).