About N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide
N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide (PubChem CID 173486664) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide.
Molecular Properties
| Compound Name | N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide |
| PubChem CID | 173486664 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide |
| SMILES | CC/N=C(\C=C(C)NC)C(=O)N[C@H](C=O)CCC=O |
| InChI | InChI=1S/C13H21N3O3/c1-4-15-12(8-10(2)14-3)13(19)16-11(9-18)6-5-7-17/h7-9,11,14H,4-6H2,1-3H3,(H,16,19)/b10-8?,15-12+/t11-/m0/s1 |
| InChIKey | NPILDSPNIPBYHV-KQHZTSLXSA-N |
| XLogP | 0.23 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide?
The IUPAC name of N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide (CID 173486664) is N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide.
What is the SMILES notation for N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide?
The canonical SMILES for N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide is CC/N=C(\C=C(C)NC)C(=O)N[C@H](C=O)CCC=O.
What is the InChIKey of N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide?
The InChIKey is NPILDSPNIPBYHV-KQHZTSLXSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-4-15-12(8-10(2)14-3)13(19)16-11(9-18)6-5-7-17/h7-9,11,14H,4-6H2,1-3H3,(H,16,19)/b10-8?,15-12+/t11-/m0/s1.
What are the key properties of N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide?
N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide has a molecular weight of 267.33 g/mol, XLogP of 0.23, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1,5-dioxopentan-2-yl]-2-ethylimino-4-(methylamino)pent-3-enamide is sourced from PubChem (CID 173486664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).