About 1-(dimethylamino)ethenyl-methylazanide;rhodium
1-(dimethylamino)ethenyl-methylazanide;rhodium (PubChem CID 173486763) has the molecular formula C5H11N2Rh-
and a molecular weight of 202.06 g/mol. Its IUPAC name is 1-(dimethylamino)ethenyl-methylazanide;rhodium.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethenyl-methylazanide;rhodium |
| PubChem CID | 173486763 |
| Molecular Formula | C5H11N2Rh- |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 1-(dimethylamino)ethenyl-methylazanide;rhodium |
| SMILES | C=C([N-]C)N(C)C.[Rh] |
| InChI | InChI=1S/C5H11N2.Rh/c1-5(6-2)7(3)4;/h1H2,2-4H3;/q-1; |
| InChIKey | AJXRVGFTLNVCMT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(dimethylamino)ethenyl-methylazanide;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethenyl-methylazanide;rhodium?
The IUPAC name of 1-(dimethylamino)ethenyl-methylazanide;rhodium (CID 173486763) is 1-(dimethylamino)ethenyl-methylazanide;rhodium.
What is the SMILES notation for 1-(dimethylamino)ethenyl-methylazanide;rhodium?
The canonical SMILES for 1-(dimethylamino)ethenyl-methylazanide;rhodium is C=C([N-]C)N(C)C.[Rh].
What is the InChIKey of 1-(dimethylamino)ethenyl-methylazanide;rhodium?
The InChIKey is AJXRVGFTLNVCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2.Rh/c1-5(6-2)7(3)4;/h1H2,2-4H3;/q-1;.
What are the key properties of 1-(dimethylamino)ethenyl-methylazanide;rhodium?
1-(dimethylamino)ethenyl-methylazanide;rhodium has a molecular weight of 202.06 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethenyl-methylazanide;rhodium is sourced from PubChem (CID 173486763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).