C21H38O3Si — CID 173486793
methyl (2Z,5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-2,7,9-trienoate (PubChem CID 173486793) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is methyl (2Z,5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-2,7,9-trienoate.
| Compound Name | methyl (2Z,5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-2,7,9-trienoate |
|---|---|
| PubChem CID | 173486793 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | methyl (2Z,5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-2,7,9-trienoate |
| SMILES | C/C=C\C(C)=C\[C@H](C)[C@H](C/C=C(/C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-11-12-16(2)15-18(4)19(14-13-17(3)20(22)23-8)24-25(9,10)21(5,6)7/h11-13,15,18-19H,14H2,1-10H3/b12-11-,16-15+,17-13-/t18-,19-/m0/s1 |
| InChIKey | COQQLZNRMDFODT-PWXJXTJRSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|