About CID 173486938
CID 173486938 (PubChem CID 173486938) has the molecular formula C4H7BN2
and a molecular weight of 93.93 g/mol.
Molecular Properties
| Compound Name | CID 173486938 |
| PubChem CID | 173486938 |
| Molecular Formula | C4H7BN2 |
| Molecular Weight | 93.93 g/mol |
| Exact Mass | 94.07 |
| IUPAC Name | — |
| SMILES | [B]N1NCCC1=C |
| InChI | InChI=1S/C4H7BN2/c1-4-2-3-6-7(4)5/h6H,1-3H2 |
| InChIKey | ICWBDJVBRSPVDX-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.93 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173486938 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173486938?
The IUPAC name of CID 173486938 (CID 173486938) is not available.
What is the SMILES notation for CID 173486938?
The canonical SMILES for CID 173486938 is [B]N1NCCC1=C.
What is the InChIKey of CID 173486938?
The InChIKey is ICWBDJVBRSPVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BN2/c1-4-2-3-6-7(4)5/h6H,1-3H2.
What are the key properties of CID 173486938?
CID 173486938 has a molecular weight of 93.93 g/mol, XLogP of -0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173486938 is sourced from PubChem (CID 173486938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).