C27H29I — CID 173487005
5-[(2Z)-1-ethylidene-2-(2-iodobutylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene (PubChem CID 173487005) has the molecular formula C27H29I and a molecular weight of 480.43 g/mol. Its IUPAC name is 5-[(2Z)-1-ethylidene-2-(2-iodobutylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene.
| Compound Name | 5-[(2Z)-1-ethylidene-2-(2-iodobutylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 173487005 |
| Molecular Formula | C27H29I |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 5-[(2Z)-1-ethylidene-2-(2-iodobutylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene |
| SMILES | CC=C1/C(=C\C(I)CC)C(C)(C)c2cc(-c3cccc4c3C=CCC4)ccc21 |
| InChI | InChI=1S/C27H29I/c1-5-20(28)17-26-21(6-2)24-15-14-19(16-25(24)27(26,3)4)23-13-9-11-18-10-7-8-12-22(18)23/h6,8-9,11-17,20H,5,7,10H2,1-4H3/b21-6?,26-17+ |
| InChIKey | BGQOZMOSYYZRHJ-GYXOCVHOSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|