C22H29N3O12S2 — CID 173487116
2-[2-[4-[1-(benzenesulfonamido)-2-ethoxy-2-oxoethyl]-1-methyl-4-nitrososulfanylpiperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate (PubChem CID 173487116) has the molecular formula C22H29N3O12S2 and a molecular weight of 591.62 g/mol. Its IUPAC name is 2-[2-[4-[1-(benzenesulfonamido)-2-ethoxy-2-oxoethyl]-1-methyl-4-nitrososulfanylpiperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate.
| Compound Name | 2-[2-[4-[1-(benzenesulfonamido)-2-ethoxy-2-oxoethyl]-1-methyl-4-nitrososulfanylpiperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 173487116 |
| Molecular Formula | C22H29N3O12S2 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | 2-[2-[4-[1-(benzenesulfonamido)-2-ethoxy-2-oxoethyl]-1-methyl-4-nitrososulfanylpiperidin-1-ium-1-yl]oxy-2-oxoethyl]-2,4-dihydroxy-4-oxobutanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccccc1)C1(SN=O)CC[N+](C)(OC(=O)CC(O)(CC(=O)O)C(=O)[O-])CC1 |
| InChI | InChI=1S/C22H29N3O12S2/c1-3-36-19(29)18(23-39(34,35)15-7-5-4-6-8-15)22(38-24-33)9-11-25(2,12-10-22)37-17(28)14-21(32,20(30)31)13-16(26)27/h4-8,18,23,32H,3,9-14H2,1-2H3,(H-,26,27,30,31) |
| InChIKey | PZDUHMKJLBDGRK-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 225.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|