C10H11BrN4OS — CID 173487829
O-methyl N-[amino-(6-bromo-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methylidene]carbamothioate (PubChem CID 173487829) has the molecular formula C10H11BrN4OS and a molecular weight of 315.20 g/mol. Its IUPAC name is O-methyl N-[amino-(6-bromo-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methylidene]carbamothioate.
| Compound Name | O-methyl N-[amino-(6-bromo-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methylidene]carbamothioate |
|---|---|
| PubChem CID | 173487829 |
| Molecular Formula | C10H11BrN4OS |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | O-methyl N-[amino-(6-bromo-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methylidene]carbamothioate |
| SMILES | COC(=S)N=C(N)C1=CNC2C=CC(Br)=CN12 |
| InChI | InChI=1S/C10H11BrN4OS/c1-16-10(17)14-9(12)7-4-13-8-3-2-6(11)5-15(7)8/h2-5,8,13H,1H3,(H2,12,14,17) |
| InChIKey | YZJLSIRBYYCLFT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|