C11H19N3O9 — CID 173488418
(2S,3R,4S,5R,6R)-2-[(3R,4R,5R,6S)-6-azido-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 173488418) has the molecular formula C11H19N3O9 and a molecular weight of 337.29 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[(3R,4R,5R,6S)-6-azido-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[(3R,4R,5R,6S)-6-azido-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 173488418 |
| Molecular Formula | C11H19N3O9 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(3R,4R,5R,6S)-6-azido-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [N-]=[N+]=N[C@H]1OC[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19N3O9/c12-14-13-10-8(19)6(17)4(2-21-10)23-11-9(20)7(18)5(16)3(1-15)22-11/h3-11,15-20H,1-2H2/t3-,4-,5+,6+,7+,8-,9-,10+,11+/m1/s1 |
| InChIKey | FKNHLANJZJHHSY-MRRNQDDQSA-N |
| XLogP | -3.44 |
| TPSA | 197.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|