C16H19N4O5S3- — CID 173488798
4-[[4-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-3-hydroxythiophene-2-sulfinate (PubChem CID 173488798) has the molecular formula C16H19N4O5S3- and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[[4-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-3-hydroxythiophene-2-sulfinate.
| Compound Name | 4-[[4-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-3-hydroxythiophene-2-sulfinate |
|---|---|
| PubChem CID | 173488798 |
| Molecular Formula | C16H19N4O5S3- |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 4-[[4-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-3-hydroxythiophene-2-sulfinate |
| SMILES | Cc1cc([C@H](/N=c2\[nH][s+]([O-])nc2Nc2csc(S(=O)[O-])c2O)C(C)C)oc1C |
| InChI | InChI=1S/C16H20N4O5S3/c1-7(2)12(11-5-8(3)9(4)25-11)18-15-14(19-28(24)20-15)17-10-6-26-16(13(10)21)27(22)23/h5-7,12,21H,1-4H3,(H,17,19)(H,18,20)(H,22,23)/p-1/t12-,28?/m1/s1 |
| InChIKey | QKCFFAVGBCYNQD-RKWVHCRBSA-M |
| XLogP | 3.39 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|