C10H11F7O — CID 173489160
(2Z,4E)-6,6,8,8,9,9,9-heptafluoro-5-methylnona-2,4-dien-2-ol (PubChem CID 173489160) has the molecular formula C10H11F7O and a molecular weight of 280.18 g/mol. Its IUPAC name is (2Z,4E)-6,6,8,8,9,9,9-heptafluoro-5-methylnona-2,4-dien-2-ol.
| Compound Name | (2Z,4E)-6,6,8,8,9,9,9-heptafluoro-5-methylnona-2,4-dien-2-ol |
|---|---|
| PubChem CID | 173489160 |
| Molecular Formula | C10H11F7O |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2Z,4E)-6,6,8,8,9,9,9-heptafluoro-5-methylnona-2,4-dien-2-ol |
| SMILES | C/C(O)=C/C=C(\C)C(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O/c1-6(3-4-7(2)18)8(11,12)5-9(13,14)10(15,16)17/h3-4,18H,5H2,1-2H3/b6-3+,7-4- |
| InChIKey | BIBKQNMAKWCBSK-JOVCIAKGSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|