C10H11F3O — CID 173489838
(1E,3Z,5Z)-4-ethenyl-1-(trifluoromethoxy)hepta-1,3,5-triene (PubChem CID 173489838) has the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. Its IUPAC name is (1E,3Z,5Z)-4-ethenyl-1-(trifluoromethoxy)hepta-1,3,5-triene.
| Compound Name | (1E,3Z,5Z)-4-ethenyl-1-(trifluoromethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 173489838 |
| Molecular Formula | C10H11F3O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1E,3Z,5Z)-4-ethenyl-1-(trifluoromethoxy)hepta-1,3,5-triene |
| SMILES | C=CC(/C=C\C)=C/C=C/OC(F)(F)F |
| InChI | InChI=1S/C10H11F3O/c1-3-6-9(4-2)7-5-8-14-10(11,12)13/h3-8H,2H2,1H3/b6-3-,8-5+,9-7- |
| InChIKey | INCUGIZKOZXILP-OMYXKEFPSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|