C19H22O6 — CID 173489953
1-[(9E)-4-ethenyl-7,8,11a-trihydroxy-5,10-dimethyl-1,11-dihydrocyclonona[c]pyran-3-ylidene]-1-hydroxypropan-2-one (PubChem CID 173489953) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[(9E)-4-ethenyl-7,8,11a-trihydroxy-5,10-dimethyl-1,11-dihydrocyclonona[c]pyran-3-ylidene]-1-hydroxypropan-2-one.
| Compound Name | 1-[(9E)-4-ethenyl-7,8,11a-trihydroxy-5,10-dimethyl-1,11-dihydrocyclonona[c]pyran-3-ylidene]-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 173489953 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(9E)-4-ethenyl-7,8,11a-trihydroxy-5,10-dimethyl-1,11-dihydrocyclonona[c]pyran-3-ylidene]-1-hydroxypropan-2-one |
| SMILES | C=CC1=C2C(C)=CC(O)=C(O)/C=C(\C)CC2(O)COC1=C(O)C(C)=O |
| InChI | InChI=1S/C19H22O6/c1-5-13-16-11(3)7-15(22)14(21)6-10(2)8-19(16,24)9-25-18(13)17(23)12(4)20/h5-7,21-24H,1,8-9H2,2-4H3/b10-6+,11-7?,15-14?,18-17? |
| InChIKey | NJYBUJIPTHLBLF-CJWDVTAZSA-N |
| XLogP | 3.21 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|