About (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine
(5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 173491482) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 173491482 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | C[C@]1(F)C=C(F)C=C(N)C1 |
| InChI | InChI=1S/C7H9F2N/c1-7(9)3-5(8)2-6(10)4-7/h2-3H,4,10H2,1H3/t7-/m0/s1 |
| InChIKey | FXNVHXNGMCPBMS-ZETCQYMHSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine (CID 173491482) is (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine is C[C@]1(F)C=C(F)C=C(N)C1.
What is the InChIKey of (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is FXNVHXNGMCPBMS-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H9F2N/c1-7(9)3-5(8)2-6(10)4-7/h2-3H,4,10H2,1H3/t7-/m0/s1.
What are the key properties of (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine?
(5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 145.15 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,5-difluoro-5-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 173491482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).