C38H26N4O4 — CID 173491811
N-[4-[(Z)-2-amino-2-(9,10-dinitroanthracen-2-yl)ethenyl]phenyl]-N-phenylnaphthalen-1-amine (PubChem CID 173491811) has the molecular formula C38H26N4O4 and a molecular weight of 602.65 g/mol. Its IUPAC name is N-[4-[(Z)-2-amino-2-(9,10-dinitroanthracen-2-yl)ethenyl]phenyl]-N-phenylnaphthalen-1-amine.
| Compound Name | N-[4-[(Z)-2-amino-2-(9,10-dinitroanthracen-2-yl)ethenyl]phenyl]-N-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 173491811 |
| Molecular Formula | C38H26N4O4 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | N-[4-[(Z)-2-amino-2-(9,10-dinitroanthracen-2-yl)ethenyl]phenyl]-N-phenylnaphthalen-1-amine |
| SMILES | N/C(=C\c1ccc(N(c2ccccc2)c2cccc3ccccc23)cc1)c1ccc2c([N+](=O)[O-])c3ccccc3c([N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C38H26N4O4/c39-35(27-19-22-33-34(24-27)38(42(45)46)32-15-7-6-14-31(32)37(33)41(43)44)23-25-17-20-29(21-18-25)40(28-11-2-1-3-12-28)36-16-8-10-26-9-4-5-13-30(26)36/h1-24H,39H2/b35-23- |
| InChIKey | HLLWCARSRJTGPX-NHYZDEDTSA-N |
| XLogP | 9.89 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|