C15H25ClN2 — CID 173491849
1,4,5,6-tetrahydropyrimidine;1,3,5-trimethyl-4,6-dimethylidenecyclohexene;hydrochloride (PubChem CID 173491849) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 1,4,5,6-tetrahydropyrimidine;1,3,5-trimethyl-4,6-dimethylidenecyclohexene;hydrochloride.
| Compound Name | 1,4,5,6-tetrahydropyrimidine;1,3,5-trimethyl-4,6-dimethylidenecyclohexene;hydrochloride |
|---|---|
| PubChem CID | 173491849 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1,4,5,6-tetrahydropyrimidine;1,3,5-trimethyl-4,6-dimethylidenecyclohexene;hydrochloride |
| SMILES | C1=NCCCN1.C=C1C(C)=CC(C)C(=C)C1C.Cl |
| InChI | InChI=1S/C11H16.C4H8N2.ClH/c1-7-6-8(2)10(4)11(5)9(7)3;1-2-5-4-6-3-1;/h6-7,11H,3-4H2,1-2,5H3;4H,1-3H2,(H,5,6);1H |
| InChIKey | LDBGQWUXIZFAFC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|