C8H18O6 — CID 173491903
(5S)-octane-2,3,4,5,6,7-hexol (PubChem CID 173491903) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is (5S)-octane-2,3,4,5,6,7-hexol.
| Compound Name | (5S)-octane-2,3,4,5,6,7-hexol |
|---|---|
| PubChem CID | 173491903 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (5S)-octane-2,3,4,5,6,7-hexol |
| SMILES | CC(O)C(O)C(O)[C@@H](O)C(O)C(C)O |
| InChI | InChI=1S/C8H18O6/c1-3(9)5(11)7(13)8(14)6(12)4(2)10/h3-14H,1-2H3/t3?,4?,5?,6?,7-,8?/m0/s1 |
| InChIKey | TUJPYMGBHBNKJE-AFNHJNAQSA-N |
| XLogP | -2.81 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |