C18H23NO4 — CID 173492682
(1S,5R,7E,13R,17S)-10,17-dihydroxy-7,18-dimethyl-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-7,9,11(18)-trien-14-one (PubChem CID 173492682) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (1S,5R,7E,13R,17S)-10,17-dihydroxy-7,18-dimethyl-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-7,9,11(18)-trien-14-one.
| Compound Name | (1S,5R,7E,13R,17S)-10,17-dihydroxy-7,18-dimethyl-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-7,9,11(18)-trien-14-one |
|---|---|
| PubChem CID | 173492682 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (1S,5R,7E,13R,17S)-10,17-dihydroxy-7,18-dimethyl-12-oxa-4-azatetracyclo[9.6.1.01,13.05,17]octadeca-7,9,11(18)-trien-14-one |
| SMILES | CC1=C2O[C@H]3C(=O)CC[C@@]4(O)[C@@H](C/C(C)=C\C=C2O)NCC[C@]134 |
| InChI | InChI=1S/C18H23NO4/c1-10-3-4-12(20)15-11(2)17-7-8-19-14(9-10)18(17,22)6-5-13(21)16(17)23-15/h3-4,14,16,19-20,22H,5-9H2,1-2H3/b10-3-,12-4?/t14-,16+,17+,18-/m1/s1 |
| InChIKey | NGXUEVBMYALRDU-BCKCPLESSA-N |
| XLogP | 1.89 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |