C14H20N6O2 — CID 173492765
1,4-bis(1-azidobutoxy)benzene (PubChem CID 173492765) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1,4-bis(1-azidobutoxy)benzene.
| Compound Name | 1,4-bis(1-azidobutoxy)benzene |
|---|---|
| PubChem CID | 173492765 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1,4-bis(1-azidobutoxy)benzene |
| SMILES | CCCC(N=[N+]=[N-])Oc1ccc(OC(CCC)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H20N6O2/c1-3-5-13(17-19-15)21-11-7-9-12(10-8-11)22-14(6-4-2)18-20-16/h7-10,13-14H,3-6H2,1-2H3 |
| InChIKey | ZCTRZPLEVLDINT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|