C29H27N2O3+ — CID 173492811
(1E,5E)-6-(1-ethylquinolin-1-ium-2-yl)-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-1-hydroxyhexa-1,5-diene-3,4-dione (PubChem CID 173492811) has the molecular formula C29H27N2O3+ and a molecular weight of 451.55 g/mol. Its IUPAC name is (1E,5E)-6-(1-ethylquinolin-1-ium-2-yl)-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-1-hydroxyhexa-1,5-diene-3,4-dione.
| Compound Name | (1E,5E)-6-(1-ethylquinolin-1-ium-2-yl)-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-1-hydroxyhexa-1,5-diene-3,4-dione |
|---|---|
| PubChem CID | 173492811 |
| Molecular Formula | C29H27N2O3+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (1E,5E)-6-(1-ethylquinolin-1-ium-2-yl)-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-1-hydroxyhexa-1,5-diene-3,4-dione |
| SMILES | CCN1/C(=C/C(=C\O)C(=O)C(=O)/C=C/c2ccc3ccccc3[n+]2CC)C=Cc2ccccc21 |
| InChI | InChI=1S/C29H26N2O3/c1-3-30-24(15-13-21-9-5-7-11-26(21)30)17-18-28(33)29(34)23(20-32)19-25-16-14-22-10-6-8-12-27(22)31(25)4-2/h5-20H,3-4H2,1-2H3/p+1/b18-17+,25-19+ |
| InChIKey | CHDQKIYOQARZNC-BRDMOXESSA-O |
| XLogP | 5.18 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|