About CID 173493551
CID 173493551 (PubChem CID 173493551) has the molecular formula C14H30B2N4
and a molecular weight of 276.05 g/mol.
Molecular Properties
| Compound Name | CID 173493551 |
| PubChem CID | 173493551 |
| Molecular Formula | C14H30B2N4 |
| Molecular Weight | 276.05 g/mol |
| Exact Mass | 276.27 |
| IUPAC Name | — |
| SMILES | [B]CN1CCN(CC)CCN(C[B])CCN(CC)CC1 |
| InChI | InChI=1S/C14H30B2N4/c1-3-17-5-9-19(13-15)11-7-18(4-2)8-12-20(14-16)10-6-17/h3-14H2,1-2H3 |
| InChIKey | BJNCRSRLAWFEPF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.05 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173493551 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173493551?
The IUPAC name of CID 173493551 (CID 173493551) is not available.
What is the SMILES notation for CID 173493551?
The canonical SMILES for CID 173493551 is [B]CN1CCN(CC)CCN(C[B])CCN(CC)CC1.
What is the InChIKey of CID 173493551?
The InChIKey is BJNCRSRLAWFEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30B2N4/c1-3-17-5-9-19(13-15)11-7-18(4-2)8-12-20(14-16)10-6-17/h3-14H2,1-2H3.
What are the key properties of CID 173493551?
CID 173493551 has a molecular weight of 276.05 g/mol, XLogP of -0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173493551 is sourced from PubChem (CID 173493551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).