C31H29NO4 — CID 173493717
(5Z)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-4-methylidene-7-phenylocta-5,7-dienoic acid (PubChem CID 173493717) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is (5Z)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-4-methylidene-7-phenylocta-5,7-dienoic acid.
| Compound Name | (5Z)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-4-methylidene-7-phenylocta-5,7-dienoic acid |
|---|---|
| PubChem CID | 173493717 |
| Molecular Formula | C31H29NO4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (5Z)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-4-methylidene-7-phenylocta-5,7-dienoic acid |
| SMILES | C=C(/C=C\C(=C)c1ccccc1)CC(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C31H29NO4/c1-21(17-18-22(2)23-11-5-4-6-12-23)19-31(3,29(33)34)32-30(35)36-20-28-26-15-9-7-13-24(26)25-14-8-10-16-27(25)28/h4-18,28H,1-2,19-20H2,3H3,(H,32,35)(H,33,34)/b18-17- |
| InChIKey | MOEVMMJDORBVRJ-ZCXUNETKSA-N |
| XLogP | 6.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|