About rutherfordium;1-(sulfinatoamino)propan-2-one
rutherfordium;1-(sulfinatoamino)propan-2-one (PubChem CID 173493730) has the molecular formula C3H6NO3RfS-
and a molecular weight of 403.15 g/mol. Its IUPAC name is rutherfordium;1-(sulfinatoamino)propan-2-one.
Molecular Properties
| Compound Name | rutherfordium;1-(sulfinatoamino)propan-2-one |
| PubChem CID | 173493730 |
| Molecular Formula | C3H6NO3RfS- |
| Molecular Weight | 403.15 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | rutherfordium;1-(sulfinatoamino)propan-2-one |
| SMILES | CC(=O)CN[S-](=O)=O.[Rf] |
| InChI | InChI=1S/C3H6NO3S.Rf/c1-3(5)2-4-8(6)7;/h2H2,1H3,(H,4,6,7);/q-1; |
| InChIKey | FHKHTDOLUGDEGL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze rutherfordium;1-(sulfinatoamino)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rutherfordium;1-(sulfinatoamino)propan-2-one?
The IUPAC name of rutherfordium;1-(sulfinatoamino)propan-2-one (CID 173493730) is rutherfordium;1-(sulfinatoamino)propan-2-one.
What is the SMILES notation for rutherfordium;1-(sulfinatoamino)propan-2-one?
The canonical SMILES for rutherfordium;1-(sulfinatoamino)propan-2-one is CC(=O)CN[S-](=O)=O.[Rf].
What is the InChIKey of rutherfordium;1-(sulfinatoamino)propan-2-one?
The InChIKey is FHKHTDOLUGDEGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO3S.Rf/c1-3(5)2-4-8(6)7;/h2H2,1H3,(H,4,6,7);/q-1;.
What are the key properties of rutherfordium;1-(sulfinatoamino)propan-2-one?
rutherfordium;1-(sulfinatoamino)propan-2-one has a molecular weight of 403.15 g/mol, XLogP of -0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for rutherfordium;1-(sulfinatoamino)propan-2-one is sourced from PubChem (CID 173493730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).