About CID 173493744
CID 173493744 (PubChem CID 173493744) has the molecular formula FO2RhS-
and a molecular weight of 185.97 g/mol.
Molecular Properties
| Compound Name | CID 173493744 |
| PubChem CID | 173493744 |
| Molecular Formula | FO2RhS- |
| Molecular Weight | 185.97 g/mol |
| Exact Mass | 185.87 |
| IUPAC Name | — |
| SMILES | O=[S-](=O)F.[Rh] |
| InChI | InChI=1S/FO2S.Rh/c1-4(2)3;/q-1; |
| InChIKey | CQPPVGPDYVTFPK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.97 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 173493744 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173493744?
The IUPAC name of CID 173493744 (CID 173493744) is not available.
What is the SMILES notation for CID 173493744?
The canonical SMILES for CID 173493744 is O=[S-](=O)F.[Rh].
What is the InChIKey of CID 173493744?
The InChIKey is CQPPVGPDYVTFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/FO2S.Rh/c1-4(2)3;/q-1;.
What are the key properties of CID 173493744?
CID 173493744 has a molecular weight of 185.97 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173493744 is sourced from PubChem (CID 173493744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).