C21H18Cl4F3NO3S — CID 173494526
N-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enyl]phenyl]methyl]-3-methylsulfonylpropanamide (PubChem CID 173494526) has the molecular formula C21H18Cl4F3NO3S and a molecular weight of 563.25 g/mol. Its IUPAC name is N-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enyl]phenyl]methyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enyl]phenyl]methyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 173494526 |
| Molecular Formula | C21H18Cl4F3NO3S |
| Molecular Weight | 563.25 g/mol |
| Exact Mass | 560.97 |
| IUPAC Name | N-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enyl]phenyl]methyl]-3-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)CCC(=O)NCc1ccc(CC=C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C21H18Cl4F3NO3S/c1-33(31,32)7-6-19(30)29-11-13-4-2-12(8-16(13)22)3-5-15(21(26,27)28)14-9-17(23)20(25)18(24)10-14/h2,4-5,8-10H,3,6-7,11H2,1H3,(H,29,30) |
| InChIKey | QVWJHUINTQPYBN-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.25 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|