C10H7F9 — CID 173494558
1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexa-1,3-diene (PubChem CID 173494558) has the molecular formula C10H7F9 and a molecular weight of 298.15 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173494558 |
| Molecular Formula | C10H7F9 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C(F)(F)C(F)(C1=CC=CCC1)C(F)(F)F |
| InChI | InChI=1S/C10H7F9/c11-7(9(14,15)16,6-4-2-1-3-5-6)8(12,13)10(17,18)19/h1-2,4H,3,5H2 |
| InChIKey | PRHBJIRYWQVGOG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|