C23H34N2O3Si — CID 173495037
(3S,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[2-(1,2-dimethylindol-5-yl)-2-oxoethyl]azetidin-2-one (PubChem CID 173495037) has the molecular formula C23H34N2O3Si and a molecular weight of 414.62 g/mol. Its IUPAC name is (3S,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[2-(1,2-dimethylindol-5-yl)-2-oxoethyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[2-(1,2-dimethylindol-5-yl)-2-oxoethyl]azetidin-2-one |
|---|---|
| PubChem CID | 173495037 |
| Molecular Formula | C23H34N2O3Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (3S,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[2-(1,2-dimethylindol-5-yl)-2-oxoethyl]azetidin-2-one |
| SMILES | Cc1cc2cc(C(=O)C[C@H]3NC(=O)[C@@H]3C(C)O[Si](C)(C)C(C)(C)C)ccc2n1C |
| InChI | InChI=1S/C23H34N2O3Si/c1-14-11-17-12-16(9-10-19(17)25(14)6)20(26)13-18-21(22(27)24-18)15(2)28-29(7,8)23(3,4)5/h9-12,15,18,21H,13H2,1-8H3,(H,24,27)/t15?,18-,21-/m1/s1 |
| InChIKey | XSPXDJORLUBNDK-DOSTUVGRSA-N |
| XLogP | 4.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|