C28H41N2+ — CID 173495315
[7-[3-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]cyclopenten-1-yl]-6-methylhepta-1,4,6-trien-3-ylidene]-diethylazanium (PubChem CID 173495315) has the molecular formula C28H41N2+ and a molecular weight of 405.65 g/mol. Its IUPAC name is [7-[3-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]cyclopenten-1-yl]-6-methylhepta-1,4,6-trien-3-ylidene]-diethylazanium.
| Compound Name | [7-[3-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]cyclopenten-1-yl]-6-methylhepta-1,4,6-trien-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 173495315 |
| Molecular Formula | C28H41N2+ |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 405.33 |
| IUPAC Name | [7-[3-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]cyclopenten-1-yl]-6-methylhepta-1,4,6-trien-3-ylidene]-diethylazanium |
| SMILES | C=CC(C=CC(C)=CC1=CC(=CC2=CC=C(N(CC)CC)CC2)CC1)=[N+](CC)CC |
| InChI | InChI=1S/C28H41N2/c1-7-27(29(8-2)9-3)17-12-23(6)20-25-13-14-26(22-25)21-24-15-18-28(19-16-24)30(10-4)11-5/h7,12,15,17-18,20-22H,1,8-11,13-14,16,19H2,2-6H3/q+1 |
| InChIKey | IXMNFMXHCZDQIU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|